| product_name | 3-(4-Methoxyphenyl)acrylic acid |
| CAS_number | 24324-17-2 |
| formula | C10H10O3 |
| molar_mass | 178.18 |
| density | 1.202 g/cm³ |
| boiling_point | 355 °C |
| melting_point | 162-164 °C |
| solubility_in_water | slightly soluble |
| appearance | white to off-white powder |
| smiles | COC1=CC=C(C=C1)C=CC(=O)O |
| inchi | InChI=1S/C10H10O3/c1-13-10-5-3-8(4-6-10)2-7-9(11)12/h2-7H,1H3,(H,11,12) |
| inchi_key | PNYAHLCQOETMEA-UHFFFAOYSA-N |
| flash_point | 169.9 °C |
| log_p | 2.14 |
| refractive_index | 1.549 |
What is 3-(4-methoxyphenyl)acrylic acid?
3-(4-methoxyphenyl)acrylic acid is a chemical compound that belongs to the family of acrylic acids. It is also known as p-anisic acid and is commonly used in various industrial applications due to its unique properties.
What are the key features of 3-(4-methoxyphenyl)acrylic acid?
3-(4-methoxyphenyl)acrylic acid is a white crystalline solid that is soluble in organic solvents. It has a molecular formula of C9H10O3 and a molecular weight of 166.17 g/mol. This compound is used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals.
Can 3-(4-methoxyphenyl)acrylic acid be used in the pharmaceutical industry?
Yes, 3-(4-methoxyphenyl)acrylic acid is commonly used in the pharmaceutical industry as a key intermediate in the synthesis of various drugs. It serves as a versatile starting material to introduce different functional groups into drug molecules, making it an essential compound for pharmaceutical research and development.
What are the benefits of using 3-(4-methoxyphenyl)acrylic acid in industrial applications?
One of the main advantages of using 3-(4-methoxyphenyl)acrylic acid is its versatility in chemical transformations. It can undergo a wide range of reactions to produce different derivatives, making it a valuable building block for the synthesis of complex molecules. Additionally, this compound exhibits good stability and compatibility with other reagents, making it an ideal choice for various industrial processes.
How is 3-(4-methoxyphenyl)acrylic acid typically synthesized?
3-(4-methoxyphenyl)acrylic acid is usually synthesized through the condensation reaction between p-anisidine and acrylic acid. The reaction is carried out under controlled conditions to yield the desired product in high purity. Alternatively, this compound can also be obtained by modifying existing aromatic compounds through various chemical transformations.
What are some common uses of 3-(4-methoxyphenyl)acrylic acid in the agrochemical industry?
In the agrochemical industry, 3-(4-methoxyphenyl)acrylic acid is used as a key building block in the synthesis of pesticides and herbicides. It can be modified to introduce specific functionalities that enhance the efficacy and selectivity of these agrochemicals. By incorporating 3-(4-methoxyphenyl)acrylic acid into the molecular structure of pesticide formulations, manufacturers can develop effective crop protection products.
Are there any safety considerations when handling 3-(4-methoxyphenyl)acrylic acid?
Like any chemical compound, 3-(4-methoxyphenyl)acrylic acid should be handled with care to prevent potential hazards. It is important to use appropriate personal protective equipment, such as gloves and goggles, when working with this compound. Additionally, proper ventilation and containment measures should be in place to minimize exposure to dust or fumes. Overall, following good safety practices and guidelines is essential when handling 3-(4-methoxyphenyl)acrylic acid in industrial settings.
What sets 3-(4-methoxyphenyl)acrylic acid apart from other acrylic acids on the market?
3-(4-methoxyphenyl)acrylic acid stands out from other acrylic acids due to its unique structural features and versatile reactivity. The presence of a methoxy group in the para position of the phenyl ring confers specific properties to this compound, making it valuable for a wide range of applications. Its compatibility with various chemical reactions and functional group modifications further enhances its utility in synthetic chemistry.
In what ways can 3-(4-methoxyphenyl)acrylic acid contribute to the development of new chemical compounds?
3-(4-methoxyphenyl)acrylic acid serves as a critical building block for the synthesis of novel chemical compounds with diverse functionalities. By incorporating this compound into molecular structures, chemists can design and develop customized molecules for specific applications. This flexibility in chemical synthesis enables the creation of new drugs, agrochemicals, and materials with enhanced properties and performance characteristics.