| product_name | (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid |
| CAS_number | 146989-09-9 |
| formula | C10H12O4 |
| molar_mass | 196.20 g/mol |
| density | 1.3 g/cm³ |
| boiling_point | 335.7 °C at 760 mmHg |
| melting_point | 78-80 °C |
| flash_point | 157.2 °C |
| refractive_index | 1.535 |
| pKa | 4.36 |
| solubility | soluble in water |
| SMILES | C1COC2(CCCCC2=C1)C=CC(=O)O |
| InChI | InChI=1S/C10H12O4/c1-8(11)9(12)14-10(13)6-4-7-2-5-7/h4,6-10H,2-3,5H2,1H3 |
What is (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid?
(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid is a compound that belongs to the class of spiro compounds, featuring a unique spiro ring structure along with an acrylic acid group.
What are the potential applications of (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid?
(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid has diverse applications in various fields, including pharmaceuticals, materials science, and organic synthesis. It can be used as a building block for the synthesis of complex molecules due to its versatile reactivity.
How is (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid synthesized?
The synthesis of (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid involves several steps starting from commercially available starting materials. The spiro ring structure is formed through a cyclization reaction, followed by the addition of the acrylic acid moiety.
What are the key properties of (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid?
(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid exhibits good solubility in common organic solvents, making it easy to handle in various reactions. It also has a stable spiro ring structure that imparts unique properties to the compound.
Are there any specific precautions to be taken while handling (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid?
As with any chemical compound, it is essential to handle (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid with proper safety precautions, including wearing appropriate personal protective equipment and working in a well-ventilated area.
What research has been conducted on (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid?
Researchers have explored the potential medicinal properties of (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid in drug discovery and development. Its unique structure has shown promise in modulating biological pathways for therapeutic purposes.
Can (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid be used in materials science?
Yes, (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid can be utilized in materials science applications, such as the synthesis of polymers with specific properties or the functionalization of surfaces for tailored functionalities.
What sets (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid apart from other compounds?
The unique spiro ring structure of (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid distinguishes it from other compounds, offering a distinctive scaffold for molecular design and synthesis.
How can one access (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid for research purposes?
(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid can be sourced from reputable chemical suppliers that offer high-quality compounds for research and development purposes. Researchers can acquire the compound for their studies and experiments.