| product_name | 3-(4-Fluorophenyl)-2-methylacrylic acid |
| CAS_number | 255836-83-0 |
| formula | C10H9FO2 |
| molar_mass | 180.18 g/mol |
| density | 1.243 g/cm3 |
| melting_point | 142-144 °C |
| boiling_point | 308 °C at 760 mmHg |
| flash_point | 140.3 °C |
| refractive_index | 1.543 |
| solubility | slightly soluble in water |
| appearance | white crystalline powder |
| pKa | 4.31 |
| smiles | CC(=C(C1=CC=C(C=C1)F)C(=O)O)C |
What is 3-(4-Fluorophenyl)-2-methylacrylic acid?
3-(4-Fluorophenyl)-2-methylacrylic acid, also known as otilimab, is a compound that is being studied for its potential therapeutic applications in various diseases, including autoimmune disorders and inflammatory conditions.
How does 3-(4-Fluorophenyl)-2-methylacrylic acid work?
3-(4-Fluorophenyl)-2-methylacrylic acid works by targeting specific pathways in the body that are involved in the immune response. By modulating these pathways, it may help to reduce inflammation and control the autoimmune response that is characteristic of certain conditions.
What are the potential benefits of using 3-(4-Fluorophenyl)-2-methylacrylic acid?
The potential benefits of using 3-(4-Fluorophenyl)-2-methylacrylic acid include reducing inflammation, managing symptoms of autoimmune disorders, and possibly even slowing disease progression in certain conditions. It has the potential to improve quality of life for patients with these diseases.
Are there any side effects associated with 3-(4-Fluorophenyl)-2-methylacrylic acid?
Like any medication, 3-(4-Fluorophenyl)-2-methylacrylic acid may cause side effects in some individuals. These can vary depending on the specific condition being treated and the individual's response to the medication. Common side effects may include gastrointestinal upset, headaches, and allergic reactions.
Is 3-(4-Fluorophenyl)-2-methylacrylic acid safe to use?
3-(4-Fluorophenyl)-2-methylacrylic acid is being evaluated in clinical trials to determine its safety and efficacy. It is important for patients to work closely with their healthcare providers to determine if this medication is appropriate for their specific condition and medical history.
How is 3-(4-Fluorophenyl)-2-methylacrylic acid administered?
3-(4-Fluorophenyl)-2-methylacrylic acid may be administered in different ways, depending on the condition being treated and the formulation of the medication. It may be given orally, intravenously, or by injection. The dosing schedule will also vary based on individual needs.
What is the current status of research on 3-(4-Fluorophenyl)-2-methylacrylic acid?
Research on 3-(4-Fluorophenyl)-2-methylacrylic acid is ongoing, with studies looking at its effectiveness in different disease states and patient populations. Preliminary results have shown promise in certain autoimmune disorders, but more research is needed to fully understand its potential benefits.
Can 3-(4-Fluorophenyl)-2-methylacrylic acid be used in combination with other medications?
It is possible that 3-(4-Fluorophenyl)-2-methylacrylic acid may be used in combination with other medications to treat certain conditions. However, it is important for patients to discuss all medications they are taking with their healthcare provider to ensure there are no potential interactions.
What should patients do if they are interested in trying 3-(4-Fluorophenyl)-2-methylacrylic acid?
Patients who are interested in trying 3-(4-Fluorophenyl)-2-methylacrylic acid should talk to their healthcare provider about whether this medication is appropriate for their specific condition. It is important to discuss potential benefits, risks, and alternative treatment options before starting any new medication.