| product_name | 3-(4-Fluorophenyl)-2-methylacrylic acid |
| CAS_number | 255836-83-0 |
| formula | C10H9FO2 |
| molar_mass | 180.18 g/mol |
| density | 1.243 g/cm3 |
| melting_point | 142-144 °C |
| boiling_point | 308 °C at 760 mmHg |
| flash_point | 140.3 °C |
| refractive_index | 1.543 |
| solubility | slightly soluble in water |
| appearance | white crystalline powder |
| pKa | 4.31 |
| smiles | CC(=C(C1=CC=C(C=C1)F)C(=O)O)C |
What is 3-(4-Fluorophenyl)-2-methylacrylic acid?
3-(4-Fluorophenyl)-2-methylacrylic
acid, also known as otilimab, is a compound that is being studied for its potential
therapeutic applications in various diseases, including autoimmune disorders and
inflammatory conditions.
How does 3-(4-Fluorophenyl)-2-methylacrylic acid
work?
3-(4-Fluorophenyl)-2-methylacrylic acid works by targeting specific pathways in
the body that are involved in the immune response. By modulating these pathways, it may help
to reduce inflammation and control the autoimmune response that is characteristic of certain
conditions.
What are the potential benefits of using
3-(4-Fluorophenyl)-2-methylacrylic acid?
The potential benefits of using
3-(4-Fluorophenyl)-2-methylacrylic acid include reducing inflammation, managing symptoms of
autoimmune disorders, and possibly even slowing disease progression in certain conditions.
It has the potential to improve quality of life for patients with these diseases.
Are
there any side effects associated with 3-(4-Fluorophenyl)-2-methylacrylic acid?
Like
any medication, 3-(4-Fluorophenyl)-2-methylacrylic acid may cause side effects in some
individuals. These can vary depending on the specific condition being treated and the
individual's response to the medication. Common side effects may include gastrointestinal
upset, headaches, and allergic reactions.
Is 3-(4-Fluorophenyl)-2-methylacrylic acid
safe to use?
3-(4-Fluorophenyl)-2-methylacrylic acid is being evaluated in clinical
trials to determine its safety and efficacy. It is important for patients to work closely
with their healthcare providers to determine if this medication is appropriate for their
specific condition and medical history.
How is 3-(4-Fluorophenyl)-2-methylacrylic
acid administered?
3-(4-Fluorophenyl)-2-methylacrylic acid may be administered in
different ways, depending on the condition being treated and the formulation of the
medication. It may be given orally, intravenously, or by injection. The dosing schedule will
also vary based on individual needs.
What is the current status of research on
3-(4-Fluorophenyl)-2-methylacrylic acid?
Research on
3-(4-Fluorophenyl)-2-methylacrylic acid is ongoing, with studies looking at its
effectiveness in different disease states and patient populations. Preliminary results have
shown promise in certain autoimmune disorders, but more research is needed to fully
understand its potential benefits.
Can 3-(4-Fluorophenyl)-2-methylacrylic acid be
used in combination with other medications?
It is possible that
3-(4-Fluorophenyl)-2-methylacrylic acid may be used in combination with other medications to
treat certain conditions. However, it is important for patients to discuss all medications
they are taking with their healthcare provider to ensure there are no potential
interactions.
What should patients do if they are interested in trying
3-(4-Fluorophenyl)-2-methylacrylic acid?
Patients who are interested in trying
3-(4-Fluorophenyl)-2-methylacrylic acid should talk to their healthcare provider about
whether this medication is appropriate for their specific condition. It is important to
discuss potential benefits, risks, and alternative treatment options before starting any new
medication.
