What is the CAS number of 3-(Diethoxymethylsilyl)propyl methacrylate?

The CAS number of 3-(Diethoxymethylsilyl)propyl methacrylate is 5089-70-3. CAS numbers, or Chemical Abstracts Service registry numbers, are unique identifiers assigned to chemical compounds.CAS numbers are unique identifiers for chemical compounds. They play a crucial role in the identification and organization of chemicals in the scientific and industrial communities.They are crucial in the identification and organization process of chemicals within the scientific and industrial community.
This particular compound, 3-(Diethoxymethylsilyl)propyl methacrylate, is an organosilicon compound. It contains both a methacrylate group and a silyl group with diethoxy substituents.It contains a silyl and a methacrylate groups with diethoxy substitutes. The methacrylate group is well - known for its ability to participate in polymerization reactions, often used to form polymers with specific properties.Methacrylate groups are well-known for their ability to participate in polymerization, and are often used to create polymers with specific characteristics. The silyl group, on the other hand, can provide additional functionality such as improved adhesion to substrates, especially those with silanol groups like glass or certain metals.The silyl group can, on the contrary, provide additional functionality, such as improved adhesion, to substrates with silanols like glass or certain metallics.

The CAS number 5089 - 70 - 3 allows for easy and accurate reference to this compound in various contexts.This compound can be easily identified by its CAS number, 5089 -70 - 3. For example, in research papers, when scientists are reporting experiments involving 3-(Diethoxymethylsilyl)propyl methacrylate, they can use this CAS number to clearly identify the chemical. In the chemical industry, during the production, handling, and storage of this compound, the CAS number is used for regulatory compliance, safety data sheets, and inventory management.The CAS number can be used in the chemical industry to ensure regulatory compliance during the production, storage, and handling of this compound.

Overall, the CAS number 5089 - 70 - 3 is an essential tool for anyone dealing with 3-(Diethoxymethylsilyl)propyl methacrylate, enabling clear communication and proper handling of the chemical.

What are the applications of 3-(Diethoxymethylsilyl)propyl methacrylate?

3-(Diethoxymethylsilyl)propyl methacrylate, often abbreviated as a silane - based monomer, has several important applications.
One significant application is in the field of surface modification.Surface modification is a significant application. When applied to various substrates like metals, ceramics, or glass, it can improve the adhesion between different materials.It can be used to improve adhesion when applied to different substrates such as metals, ceramics or glass. For example, in the manufacture of composite materials, this compound can act as a coupling agent.This compound can be used as a coupling material in the production of composite materials. It forms a chemical bond with the inorganic substrate on one end through the silane groups, while the methacrylate group can polymerize with organic polymers.The silane groups form a chemical link with the inorganic material on one end, while the methacrylate groups can polymerize organic polymers. This enhances the interfacial adhesion between the inorganic filler and the organic matrix, resulting in composites with improved mechanical properties such as strength and durability.This increases the interfacial adhesiveness between the inorganic matrix and the inorganic filler, resulting composites with improved mechanical characteristics such as strength and durability.

In the coatings industry, 3-(Diethoxymethylsilyl)propyl methacrylate is used to enhance the performance of coatings. By incorporating it into coating formulations, it can improve the adhesion of the coating to the substrate, making the coating more resistant to peeling and flaking.It can be added to coating formulations to improve adhesion to the substrate. This makes the coating more resistant against peeling and flaking. Additionally, the silane part can contribute to the formation of a cross - linked network within the coating, enhancing its chemical resistance, abrasion resistance, and weatherability.The silane component can also contribute to the formation a cross-linked network within the coating. This will enhance its chemical resistance, weatherability, and abrasion resistance. This is particularly useful for coatings applied to outdoor structures or industrial equipment that are exposed to harsh environmental conditions.This is especially useful for coatings that are applied to outdoor structures and industrial equipment exposed to harsh conditions.

It also finds use in the production of adhesives.It is also used in the production adhesives. The dual - functionality of this compound allows it to bond different types of materials together effectively.This compound has two functions, which allows it to bond materials effectively. For instance, in the assembly of electronic devices where components made of different materials need to be joined, adhesives containing 3-(Diethoxymethylsilyl)propyl methacrylate can provide strong and reliable bonds. The silane groups can interact with the surfaces of metals or ceramics in the electronic components, while the methacrylate groups participate in the curing process of the adhesive, ensuring a stable and long - lasting connection.The silane groups interact with the surfaces on metals and ceramics of electronic components while the methacrylate group participates in the curing of the adhesive. This ensures a long-lasting and stable connection.

In the area of polymer modification, this compound can be copolymerized with other monomers.This compound can be copolymerized in the polymer modification area with other monomers. The introduction of the silane - containing unit can impart unique properties to the polymer.The introduction of a silane-containing unit can confer unique properties to the material. For example, it can improve the hydrophilicity or hydrophobicity of the polymer depending on the application requirements.It can, for example, improve the hydrophilicity of the polymer based on the application requirements. It can also enhance the thermal stability of the polymer.It can also improve the thermal stability. When used in the synthesis of hydrogels, for example, it can modify the gel's mechanical properties and its interaction with biological fluids, making it potentially useful in biomedical applications such as drug delivery systems or tissue engineering scaffolds.It can be used to modify the hydrogel's mechanical properties, and its interaction with biofluids. This makes it useful for biomedical applications, such as drug delivery systems, or tissue engineering scaffolds.

What is the chemical structure of 3-(Diethoxymethylsilyl)propyl methacrylate?

3-(Diethoxymethylsilyl)propyl methacrylate is an organosilicon compound with a specific chemical structure.
Let's break down its structure description.Let's break it down into its structure description. The compound contains three main parts.The compound is composed of three main parts. First, there is a methacrylate group.The first part is the methacrylate group. The methacrylate group has a structure where a carbon - carbon double bond is attached to a carbonyl group (C=O).The methacrylate has a structure in which a double carbon-carbon bond is attached to the carbonyl group. The formula for the methacrylate group is -CH2=C(CH3)-COO-.The formula for the methacrylate is -CH2=C (CH3)-COO. This part of the molecule is responsible for the polymerizable nature of the compound, as the carbon - carbon double bond can participate in polymerization reactions, for example, radical polymerization.This part of a molecule is responsible, as the double carbon-carbon bond can participate in polymerization, such as radical polymerization.

Second, there is a propyl linker.Second, there's a linker made of propyl. The propyl group is a three - carbon straight - chain alkyl group, -CH2CH2CH2-.The propyl group consists of a three-carbon straight-chain alkyl group -CH2CH2CH2-. It serves as a spacer between the methacrylate group and the silicon - containing part of the molecule.It acts as a spacer to separate the methacrylate from the silicon-containing part of a molecule. This linker helps in providing some flexibility and distance between the reactive methacrylate end and the silicon - functional group.This linker provides flexibility and distance between a reactive methacrylate and a silicon-containing group.

Finally, there is the silicon - containing part, which is the diethoxymethylsilyl group.The diethoxymethylsilyl groups is the final part that contains silicon. The silicon atom is at the center of this group.This group is centered on the silicon atom. It is bonded to one methyl group (-CH3) and two ethoxy groups (-OCH2CH3).It is bonded with two ethoxy groups and one methyl group. The general formula for this part is -Si(CH3)(OCH2CH3)2.This part has the general formula -Si (CH3)(OCH2CH3)2. The silicon atom in this group can react with other substances, for example, it can form siloxane bonds with other silicon - containing compounds or interact with substrates through hydrolysis and subsequent condensation reactions.The silicon atom can react with other substances. For example, it can form a siloxane bond with other silicon-containing compounds, or interact with substrates by hydrolysis and subsequent condensing reactions.

Combining these parts together, the chemical structure of 3-(Diethoxymethylsilyl)propyl methacrylate can be written as CH2=C(CH3)COOCH2CH2CH2Si(CH3)(OCH2CH3)2. This overall structure gives the compound unique properties.This structure gives the compound its unique properties. The methacrylate end allows it to be incorporated into polymer matrices, while the silicon - containing end can interact with inorganic materials such as glass or silica surfaces.The methacrylate-containing end can be incorporated into polymer matrixes while the silicon-containing end can interact inorganic materials like glass or silica. This makes it a useful coupling agent in applications where bonding between organic polymers and inorganic materials is required, like in composite materials production.This makes it an effective coupling agent for applications that require bonding between inorganic and organic materials, such as composite materials.

What are the physical properties of 3-(Diethoxymethylsilyl)propyl methacrylate?

3-(Diethoxymethylsilyl)propyl methacrylate is an organosilicon compound with distinct physical properties.
In terms of appearance, it is typically a clear to slightly yellowish liquid.It is usually a clear liquid that can be slightly yellowish. This visual characteristic is common among many organic and organosilicon substances in their pure form.In their pure form, this visual characteristic is found in many organic and organosilicon compounds. The clarity allows for easy inspection and identification in various applications.The clarity of the material allows for easy inspection and recognition in various applications.

Regarding its state at room temperature, being a liquid provides certain advantages.Being a liquid at room temperature has certain advantages. Liquids can be more easily handled, measured, and mixed with other substances compared to solids.Liquids are easier to handle, measure, and mix with other substances than solids. This property makes it convenient for use in processes such as coatings, adhesives, and composites manufacturing.This property makes it easy to use in processes like coatings, adhesives and composites manufacturing.

The compound has a specific gravity.The compound has a specific density. The specific gravity determines its relative density compared to water.The specific gravity is used to determine the relative density of a compound in comparison to water. A particular value of specific gravity indicates whether it will float or sink in water.A specific gravity value will determine whether a substance will float or settle in water. This property is crucial when considering its behavior in aqueous or multiphase systems.This property is critical when analyzing its behavior in aqueous and multiphase systems.

Viscosity is another important physical property.Viscosity is an important physical property. The viscosity of 3-(Diethoxymethylsilyl)propyl methacrylate affects its flow characteristics. A relatively low viscosity enables it to spread easily over surfaces, which is beneficial for coating applications.Its low viscosity makes it easy to spread over surfaces. This is great for coating applications. It ensures a smooth and even distribution, leading to high - quality coatings.It allows for a smooth, even distribution that leads to high-quality coatings. On the other hand, if the viscosity is too low, it may cause issues like dripping.If the viscosity of the coating is too low, this can cause problems such as dripping.

Boiling point is also a notable property.The boiling point is another notable property. Knowing the boiling point helps in processes that involve heating or distillation.Knowing the boiling point is useful for processes that involve heating and distillation. If the compound needs to be separated from a mixture, the boiling point information is essential for choosing the appropriate temperature conditions for distillation.The boiling point is important for selecting the right temperature conditions to distill the compound from a mixture.

It has a certain solubility profile.It has a specific solubility profile. It is often soluble in common organic solvents, which broadens its application scope.It is soluble in many organic solvents. This broadens the scope of its application. Solubility in organic solvents allows it to be incorporated into various formulations, such as those used in the production of polymers.Its solubility in organic solvants allows it to be incorporated in various formulations such as those used for the production of polymers. This solubility also affects how it interacts with other components in a formulation, influencing the overall performance of the final product.This solubility affects the way it interacts with the other components of a formulation and influences the overall performance.

The refractive index is a property related to how light passes through the compound.The refractive indices is a property that relates to how light travels through a compound. The refractive index can impact the optical properties of materials when 3-(Diethoxymethylsilyl)propyl methacrylate is used in applications where transparency and light - handling are important, like in some optical coatings.

What are the safety precautions when handling 3-(Diethoxymethylsilyl)propyl methacrylate?

When handling 3-(Diethoxymethylsilyl)propyl methacrylate, several safety precautions are necessary.
First, personal protective equipment should be worn.Wear personal protective equipment first. This includes chemical - resistant gloves.Chemical-resistant gloves are a must. The gloves should be made of materials like nitrile, which can effectively resist the potential contact of the chemical with the skin.The gloves should be made from materials such as nitrile that can effectively resist contact with the chemical. Contact with the skin can lead to irritation, and in some cases, allergic reactions.Contact with the skin may cause irritation and, in some cases allergic reactions. Wearing appropriate gloves can prevent such issues.Wearing gloves that are appropriate can help prevent this. Additionally, safety goggles are essential.Safety goggles and gloves are also essential. This chemical can splash during handling, and getting it into the eyes can cause severe eye damage, including corneal abrasions or even loss of vision.This chemical can splash when handled, and if it gets into the eyes, it can cause severe eye injuries, including corneal damage or even blindness. Goggles provide a physical barrier to protect the eyes.Goggles protect the eyes by providing a physical barrier.

Second, proper ventilation is crucial.Proper ventilation is also important. 3-(Diethoxymethylsilyl)propyl methacrylate may release vapors. Inhalation of these vapors can irritate the respiratory tract, causing coughing, shortness of breath, and in more severe cases, lung damage.Inhalation can cause irritation of the respiratory tract resulting in coughing, shortness breath, or even lung damage. Working in a well - ventilated area, such as a fume hood, can effectively remove the vapors from the breathing zone.A fume hood or other well-ventilated area can remove the vapors effectively from the breathing zone. If a fume hood is not available, ensure the work area has good general ventilation with fans or open windows.If a fume-hood is not available, open windows or use fans to provide good ventilation.

Third, be cautious about storage.Third, be careful about storage. Store this chemical in a cool, dry place away from sources of heat and ignition.Store this chemical in an area that is cool and dry, away from heat sources and ignition. It is flammable, and heat or an open flame can cause it to catch fire.It is flammable and can catch fire if exposed to heat or an open flame. Keep it in a tightly - sealed container to prevent leakage and evaporation.Keep it in an airtight container to prevent evaporation and leakage. Label the container clearly with the chemical name, hazards, and handling instructions.Label the container with the chemical name, the hazards and the handling instructions. This ensures that anyone who comes across it is aware of the potential risks.This will ensure that anyone who comes into contact with the container is aware of any potential risks.

Fourth, in case of accidental contact, have a clear plan.Fourth, be prepared with a plan in case of an accidental contact. If it gets on the skin, immediately wash the affected area with plenty of soap and water for at least 15 minutes.If it gets onto the skin, wash the area immediately with soap and water. This should last at least 15 minutes. If it gets into the eyes, rinse them thoroughly with water for at least 15 minutes and seek immediate medical attention.If it gets in the eyes, wash them thoroughly for at least 15 mins with plenty of water and seek immediate medical care. In case of inhalation, move to fresh air immediately.In the event of inhalation, you should move to fresh air as soon as possible. If the person is not breathing, perform CPR if trained to do so and call for emergency medical help.If the person does not breathe, call emergency medical help and perform CPR.

Finally, when disposing of this chemical or any waste containing it, follow local environmental regulations.Follow local environmental regulations when disposing this chemical or any waste that contains it. Improper disposal can contaminate the environment, including soil and water sources.Unsafe disposal can contaminate soil and water. Contact the appropriate waste management facilities to ensure proper and safe disposal.Contact the appropriate waste disposal facilities to ensure safe and proper disposal.